C13H18N2 — CID 106899630
N-[(4-ethylphenyl)methyl]-3,4-dihydro-2H-pyrrol-5-amine (PubChem CID 106899630) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is N-[(4-ethylphenyl)methyl]-3,4-dihydro-2H-pyrrol-5-amine.
| Compound Name | N-[(4-ethylphenyl)methyl]-3,4-dihydro-2H-pyrrol-5-amine |
|---|---|
| PubChem CID | 106899630 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | N-[(4-ethylphenyl)methyl]-3,4-dihydro-2H-pyrrol-5-amine |
| SMILES | CCc1ccc(CNC2=NCCC2)cc1 |
| InChI | InChI=1S/C13H18N2/c1-2-11-5-7-12(8-6-11)10-15-13-4-3-9-14-13/h5-8H,2-4,9-10H2,1H3,(H,14,15) |
| InChIKey | CHWWPEYGSUXMOP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |