C20H24ClNOS — CID 10689987
5-(2-chlorophenyl)sulfanyl-N-(3-phenylpropyl)pentanamide (PubChem CID 10689987) has the molecular formula C20H24ClNOS and a molecular weight of 361.94 g/mol. Its IUPAC name is 5-(2-chlorophenyl)sulfanyl-N-(3-phenylpropyl)pentanamide.
| Compound Name | 5-(2-chlorophenyl)sulfanyl-N-(3-phenylpropyl)pentanamide |
|---|---|
| PubChem CID | 10689987 |
| Molecular Formula | C20H24ClNOS |
| Molecular Weight | 361.94 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 5-(2-chlorophenyl)sulfanyl-N-(3-phenylpropyl)pentanamide |
| SMILES | O=C(CCCCSc1ccccc1Cl)NCCCc1ccccc1 |
| InChI | InChI=1S/C20H24ClNOS/c21-18-12-4-5-13-19(18)24-16-7-6-14-20(23)22-15-8-11-17-9-2-1-3-10-17/h1-5,9-10,12-13H,6-8,11,14-16H2,(H,22,23) |
| InChIKey | LTUIIXXEAVHMNK-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.94 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|