About 5-amino-2-(4-amino-3-fluorophenyl)-7-[(dimethylamino)methyl]-6,8-difluorochromen-4-one
5-amino-2-(4-amino-3-fluorophenyl)-7-[(dimethylamino)methyl]-6,8-difluorochromen-4-one (PubChem CID 10690070) has the molecular formula C18H16F3N3O2
and a molecular weight of 363.34 g/mol. Its IUPAC name is 5-amino-2-(4-amino-3-fluorophenyl)-7-[(dimethylamino)methyl]-6,8-difluorochromen-4-one.
Molecular Properties
| Compound Name | 5-amino-2-(4-amino-3-fluorophenyl)-7-[(dimethylamino)methyl]-6,8-difluorochromen-4-one |
| PubChem CID | 10690070 |
| Molecular Formula | C18H16F3N3O2 |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 5-amino-2-(4-amino-3-fluorophenyl)-7-[(dimethylamino)methyl]-6,8-difluorochromen-4-one |
| SMILES | CN(C)Cc1c(F)c(N)c2c(=O)cc(-c3ccc(N)c(F)c3)oc2c1F |
| InChI | InChI=1S/C18H16F3N3O2/c1-24(2)7-9-15(20)17(23)14-12(25)6-13(26-18(14)16(9)21)8-3-4-11(22)10(19)5-8/h3-6H,7,22-23H2,1-2H3 |
| InChIKey | UPNLGZHAXURRDM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 85.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-2-(4-amino-3-fluorophenyl)-7-[(dimethylamino)methyl]-6,8-difluorochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2-(4-amino-3-fluorophenyl)-7-[(dimethylamino)methyl]-6,8-difluorochromen-4-one?
The IUPAC name of 5-amino-2-(4-amino-3-fluorophenyl)-7-[(dimethylamino)methyl]-6,8-difluorochromen-4-one (CID 10690070) is 5-amino-2-(4-amino-3-fluorophenyl)-7-[(dimethylamino)methyl]-6,8-difluorochromen-4-one.
What is the SMILES notation for 5-amino-2-(4-amino-3-fluorophenyl)-7-[(dimethylamino)methyl]-6,8-difluorochromen-4-one?
The canonical SMILES for 5-amino-2-(4-amino-3-fluorophenyl)-7-[(dimethylamino)methyl]-6,8-difluorochromen-4-one is CN(C)Cc1c(F)c(N)c2c(=O)cc(-c3ccc(N)c(F)c3)oc2c1F.
What is the InChIKey of 5-amino-2-(4-amino-3-fluorophenyl)-7-[(dimethylamino)methyl]-6,8-difluorochromen-4-one?
The InChIKey is UPNLGZHAXURRDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16F3N3O2/c1-24(2)7-9-15(20)17(23)14-12(25)6-13(26-18(14)16(9)21)8-3-4-11(22)10(19)5-8/h3-6H,7,22-23H2,1-2H3.
What are the key properties of 5-amino-2-(4-amino-3-fluorophenyl)-7-[(dimethylamino)methyl]-6,8-difluorochromen-4-one?
5-amino-2-(4-amino-3-fluorophenyl)-7-[(dimethylamino)methyl]-6,8-difluorochromen-4-one has a molecular weight of 363.34 g/mol, XLogP of 3.10, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-(4-amino-3-fluorophenyl)-7-[(dimethylamino)methyl]-6,8-difluorochromen-4-one is sourced from PubChem (CID 10690070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).