C17H23N3O — CID 106901108
[3-[(4-ethylphenyl)methyl]imidazol-4-yl]-(oxolan-3-yl)methanamine (PubChem CID 106901108) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is [3-[(4-ethylphenyl)methyl]imidazol-4-yl]-(oxolan-3-yl)methanamine.
| Compound Name | [3-[(4-ethylphenyl)methyl]imidazol-4-yl]-(oxolan-3-yl)methanamine |
|---|---|
| PubChem CID | 106901108 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | [3-[(4-ethylphenyl)methyl]imidazol-4-yl]-(oxolan-3-yl)methanamine |
| SMILES | CCc1ccc(Cn2cncc2C(N)C2CCOC2)cc1 |
| InChI | InChI=1S/C17H23N3O/c1-2-13-3-5-14(6-4-13)10-20-12-19-9-16(20)17(18)15-7-8-21-11-15/h3-6,9,12,15,17H,2,7-8,10-11,18H2,1H3 |
| InChIKey | USFBSSHXKWYGIS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |