C16H15ClN2O — CID 106901174
N-(4-chlorophenyl)-1,2,3,4-tetrahydroquinoline-3-carboxamide (PubChem CID 106901174) has the molecular formula C16H15ClN2O and a molecular weight of 286.76 g/mol. Its IUPAC name is N-(4-chlorophenyl)-1,2,3,4-tetrahydroquinoline-3-carboxamide.
| Compound Name | N-(4-chlorophenyl)-1,2,3,4-tetrahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 106901174 |
| Molecular Formula | C16H15ClN2O |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | N-(4-chlorophenyl)-1,2,3,4-tetrahydroquinoline-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)C1CNc2ccccc2C1 |
| InChI | InChI=1S/C16H15ClN2O/c17-13-5-7-14(8-6-13)19-16(20)12-9-11-3-1-2-4-15(11)18-10-12/h1-8,12,18H,9-10H2,(H,19,20) |
| InChIKey | AQEDLERZYSDZIG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |