C14H17NO3 — CID 106902190
1-butanoyl-3,4-dihydro-2H-quinoline-3-carboxylic acid (PubChem CID 106902190) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is 1-butanoyl-3,4-dihydro-2H-quinoline-3-carboxylic acid.
| Compound Name | 1-butanoyl-3,4-dihydro-2H-quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 106902190 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 1-butanoyl-3,4-dihydro-2H-quinoline-3-carboxylic acid |
| SMILES | CCCC(=O)N1CC(C(=O)O)Cc2ccccc21 |
| InChI | InChI=1S/C14H17NO3/c1-2-5-13(16)15-9-11(14(17)18)8-10-6-3-4-7-12(10)15/h3-4,6-7,11H,2,5,8-9H2,1H3,(H,17,18) |
| InChIKey | UDHZKKQCOLTLKL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |