C16H21NO3 — CID 106902946
1-(oxan-2-ylmethyl)-3,4-dihydro-2H-quinoline-3-carboxylic acid (PubChem CID 106902946) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is 1-(oxan-2-ylmethyl)-3,4-dihydro-2H-quinoline-3-carboxylic acid.
| Compound Name | 1-(oxan-2-ylmethyl)-3,4-dihydro-2H-quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 106902946 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 1-(oxan-2-ylmethyl)-3,4-dihydro-2H-quinoline-3-carboxylic acid |
| SMILES | O=C(O)C1Cc2ccccc2N(CC2CCCCO2)C1 |
| InChI | InChI=1S/C16H21NO3/c18-16(19)13-9-12-5-1-2-7-15(12)17(10-13)11-14-6-3-4-8-20-14/h1-2,5,7,13-14H,3-4,6,8-11H2,(H,18,19) |
| InChIKey | DDCIAUJZKSFTHG-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |