C18H29NO3SSi — CID 10690342
(4R,5S)-4,5-diethyl-1-(4-methylphenyl)sulfonyl-3-trimethylsilylpyrrolidin-2-one (PubChem CID 10690342) has the molecular formula C18H29NO3SSi and a molecular weight of 367.59 g/mol. Its IUPAC name is (4R,5S)-4,5-diethyl-1-(4-methylphenyl)sulfonyl-3-trimethylsilylpyrrolidin-2-one.
| Compound Name | (4R,5S)-4,5-diethyl-1-(4-methylphenyl)sulfonyl-3-trimethylsilylpyrrolidin-2-one |
|---|---|
| PubChem CID | 10690342 |
| Molecular Formula | C18H29NO3SSi |
| Molecular Weight | 367.59 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | (4R,5S)-4,5-diethyl-1-(4-methylphenyl)sulfonyl-3-trimethylsilylpyrrolidin-2-one |
| SMILES | CC[C@H]1C([Si](C)(C)C)C(=O)N(S(=O)(=O)c2ccc(C)cc2)[C@H]1CC |
| InChI | InChI=1S/C18H29NO3SSi/c1-7-15-16(8-2)19(18(20)17(15)24(4,5)6)23(21,22)14-11-9-13(3)10-12-14/h9-12,15-17H,7-8H2,1-6H3/t15-,16+,17?/m1/s1 |
| InChIKey | MIRVYKMLEJAXIS-GARXDOFDSA-N |
| XLogP | 4.04 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.59 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|