C17H26N2O2 — CID 106904201
6-[(4-tert-butylazepan-1-yl)methyl]pyridine-2-carboxylic acid (PubChem CID 106904201) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 6-[(4-tert-butylazepan-1-yl)methyl]pyridine-2-carboxylic acid.
| Compound Name | 6-[(4-tert-butylazepan-1-yl)methyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 106904201 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 6-[(4-tert-butylazepan-1-yl)methyl]pyridine-2-carboxylic acid |
| SMILES | CC(C)(C)C1CCCN(Cc2cccc(C(=O)O)n2)CC1 |
| InChI | InChI=1S/C17H26N2O2/c1-17(2,3)13-6-5-10-19(11-9-13)12-14-7-4-8-15(18-14)16(20)21/h4,7-8,13H,5-6,9-12H2,1-3H3,(H,20,21) |
| InChIKey | UCKBJHIFMNDLPF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |