C16H23N3O2 — CID 106904232
6-[(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)methyl]pyridine-2-carboxylic acid (PubChem CID 106904232) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 6-[(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)methyl]pyridine-2-carboxylic acid.
| Compound Name | 6-[(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)methyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 106904232 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 6-[(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)methyl]pyridine-2-carboxylic acid |
| SMILES | CC1CN2CCCCC2CN1Cc1cccc(C(=O)O)n1 |
| InChI | InChI=1S/C16H23N3O2/c1-12-9-18-8-3-2-6-14(18)11-19(12)10-13-5-4-7-15(17-13)16(20)21/h4-5,7,12,14H,2-3,6,8-11H2,1H3,(H,20,21) |
| InChIKey | AFEADIXUVIYQQM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |