About 3-(1H-imidazol-5-yl)propyl 3-iodo-4-methylbenzoate
3-(1H-imidazol-5-yl)propyl 3-iodo-4-methylbenzoate (PubChem CID 10690489) has the molecular formula C14H15IN2O2
and a molecular weight of 370.19 g/mol. Its IUPAC name is 3-(1H-imidazol-5-yl)propyl 3-iodo-4-methylbenzoate.
Molecular Properties
| Compound Name | 3-(1H-imidazol-5-yl)propyl 3-iodo-4-methylbenzoate |
| PubChem CID | 10690489 |
| Molecular Formula | C14H15IN2O2 |
| Molecular Weight | 370.19 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | 3-(1H-imidazol-5-yl)propyl 3-iodo-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCCCc2cnc[nH]2)cc1I |
| InChI | InChI=1S/C14H15IN2O2/c1-10-4-5-11(7-13(10)15)14(18)19-6-2-3-12-8-16-9-17-12/h4-5,7-9H,2-3,6H2,1H3,(H,16,17) |
| InChIKey | XKMBMTGLECYSDL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.19 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-(1H-imidazol-5-yl)propyl 3-iodo-4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1H-imidazol-5-yl)propyl 3-iodo-4-methylbenzoate?
The IUPAC name of 3-(1H-imidazol-5-yl)propyl 3-iodo-4-methylbenzoate (CID 10690489) is 3-(1H-imidazol-5-yl)propyl 3-iodo-4-methylbenzoate.
What is the SMILES notation for 3-(1H-imidazol-5-yl)propyl 3-iodo-4-methylbenzoate?
The canonical SMILES for 3-(1H-imidazol-5-yl)propyl 3-iodo-4-methylbenzoate is Cc1ccc(C(=O)OCCCc2cnc[nH]2)cc1I.
What is the InChIKey of 3-(1H-imidazol-5-yl)propyl 3-iodo-4-methylbenzoate?
The InChIKey is XKMBMTGLECYSDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15IN2O2/c1-10-4-5-11(7-13(10)15)14(18)19-6-2-3-12-8-16-9-17-12/h4-5,7-9H,2-3,6H2,1H3,(H,16,17).
What are the key properties of 3-(1H-imidazol-5-yl)propyl 3-iodo-4-methylbenzoate?
3-(1H-imidazol-5-yl)propyl 3-iodo-4-methylbenzoate has a molecular weight of 370.19 g/mol, XLogP of 3.11, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1H-imidazol-5-yl)propyl 3-iodo-4-methylbenzoate is sourced from PubChem (CID 10690489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).