C15H23N3O2 — CID 106905086
methyl 6-[[5-(aminomethyl)-2-methylpiperidin-1-yl]methyl]pyridine-2-carboxylate (PubChem CID 106905086) has the molecular formula C15H23N3O2 and a molecular weight of 277.37 g/mol. Its IUPAC name is methyl 6-[[5-(aminomethyl)-2-methylpiperidin-1-yl]methyl]pyridine-2-carboxylate.
| Compound Name | methyl 6-[[5-(aminomethyl)-2-methylpiperidin-1-yl]methyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 106905086 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | methyl 6-[[5-(aminomethyl)-2-methylpiperidin-1-yl]methyl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cccc(CN2CC(CN)CCC2C)n1 |
| InChI | InChI=1S/C15H23N3O2/c1-11-6-7-12(8-16)9-18(11)10-13-4-3-5-14(17-13)15(19)20-2/h3-5,11-12H,6-10,16H2,1-2H3 |
| InChIKey | CMNYBZWJPSKSIV-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |