C22H19N3O3 — CID 10690740
10,10-dimethyl-4-(4-nitrophenyl)-11-oxa-3,5-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),13,15-hexaene (PubChem CID 10690740) has the molecular formula C22H19N3O3 and a molecular weight of 373.41 g/mol. Its IUPAC name is 10,10-dimethyl-4-(4-nitrophenyl)-11-oxa-3,5-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),13,15-hexaene.
| Compound Name | 10,10-dimethyl-4-(4-nitrophenyl)-11-oxa-3,5-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),13,15-hexaene |
|---|---|
| PubChem CID | 10690740 |
| Molecular Formula | C22H19N3O3 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 10,10-dimethyl-4-(4-nitrophenyl)-11-oxa-3,5-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),13,15-hexaene |
| SMILES | CC1(C)CCc2c(c3ccccc3c3[nH]c(-c4ccc([N+](=O)[O-])cc4)nc23)O1 |
| InChI | InChI=1S/C22H19N3O3/c1-22(2)12-11-17-19-18(15-5-3-4-6-16(15)20(17)28-22)23-21(24-19)13-7-9-14(10-8-13)25(26)27/h3-10H,11-12H2,1-2H3,(H,23,24) |
| InChIKey | XJQANOXEXMZCLB-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 81.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|