About N,N-dimethyl-4-[(tripyrrolidin-1-yl-λ5-phosphanylidene)amino]aniline
N,N-dimethyl-4-[(tripyrrolidin-1-yl-λ5-phosphanylidene)amino]aniline (PubChem CID 10690887) has the molecular formula C20H34N5P
and a molecular weight of 375.50 g/mol. Its IUPAC name is N,N-dimethyl-4-[(tripyrrolidin-1-yl-λ5-phosphanylidene)amino]aniline.
Molecular Properties
| Compound Name | N,N-dimethyl-4-[(tripyrrolidin-1-yl-λ5-phosphanylidene)amino]aniline |
| PubChem CID | 10690887 |
| Molecular Formula | C20H34N5P |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.26 |
| IUPAC Name | N,N-dimethyl-4-[(tripyrrolidin-1-yl-λ5-phosphanylidene)amino]aniline |
| SMILES | CN(C)c1ccc(N=P(N2CCCC2)(N2CCCC2)N2CCCC2)cc1 |
| InChI | InChI=1S/C20H34N5P/c1-22(2)20-11-9-19(10-12-20)21-26(23-13-3-4-14-23,24-15-5-6-16-24)25-17-7-8-18-25/h9-12H,3-8,13-18H2,1-2H3 |
| InChIKey | BAXNDJHJIJRSCX-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 25.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyl-4-[(tripyrrolidin-1-yl-λ5-phosphanylidene)amino]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-4-[(tripyrrolidin-1-yl-λ5-phosphanylidene)amino]aniline?
The IUPAC name of N,N-dimethyl-4-[(tripyrrolidin-1-yl-λ5-phosphanylidene)amino]aniline (CID 10690887) is N,N-dimethyl-4-[(tripyrrolidin-1-yl-λ5-phosphanylidene)amino]aniline.
What is the SMILES notation for N,N-dimethyl-4-[(tripyrrolidin-1-yl-λ5-phosphanylidene)amino]aniline?
The canonical SMILES for N,N-dimethyl-4-[(tripyrrolidin-1-yl-λ5-phosphanylidene)amino]aniline is CN(C)c1ccc(N=P(N2CCCC2)(N2CCCC2)N2CCCC2)cc1.
What is the InChIKey of N,N-dimethyl-4-[(tripyrrolidin-1-yl-λ5-phosphanylidene)amino]aniline?
The InChIKey is BAXNDJHJIJRSCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H34N5P/c1-22(2)20-11-9-19(10-12-20)21-26(23-13-3-4-14-23,24-15-5-6-16-24)25-17-7-8-18-25/h9-12H,3-8,13-18H2,1-2H3.
What are the key properties of N,N-dimethyl-4-[(tripyrrolidin-1-yl-λ5-phosphanylidene)amino]aniline?
N,N-dimethyl-4-[(tripyrrolidin-1-yl-λ5-phosphanylidene)amino]aniline has a molecular weight of 375.50 g/mol, XLogP of 4.62, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-4-[(tripyrrolidin-1-yl-λ5-phosphanylidene)amino]aniline is sourced from PubChem (CID 10690887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).