C11H14F3N3O2 — CID 106908961
6-(4,4,4-trifluorobutoxymethyl)pyridine-2-carbohydrazide (PubChem CID 106908961) has the molecular formula C11H14F3N3O2 and a molecular weight of 277.25 g/mol. Its IUPAC name is 6-(4,4,4-trifluorobutoxymethyl)pyridine-2-carbohydrazide.
| Compound Name | 6-(4,4,4-trifluorobutoxymethyl)pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 106908961 |
| Molecular Formula | C11H14F3N3O2 |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 6-(4,4,4-trifluorobutoxymethyl)pyridine-2-carbohydrazide |
| SMILES | NNC(=O)c1cccc(COCCCC(F)(F)F)n1 |
| InChI | InChI=1S/C11H14F3N3O2/c12-11(13,14)5-2-6-19-7-8-3-1-4-9(16-8)10(18)17-15/h1,3-4H,2,5-7,15H2,(H,17,18) |
| InChIKey | VVKSUJJWYVSTLA-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|