C24H40O3 — CID 10690960
(E)-1-[2-[2-[(4S)-2,2-diethyl-1,3-dioxolan-4-yl]ethyl]cyclohexen-1-yl]non-2-en-1-one (PubChem CID 10690960) has the molecular formula C24H40O3 and a molecular weight of 376.58 g/mol. Its IUPAC name is (E)-1-[2-[2-[(4S)-2,2-diethyl-1,3-dioxolan-4-yl]ethyl]cyclohexen-1-yl]non-2-en-1-one.
| Compound Name | (E)-1-[2-[2-[(4S)-2,2-diethyl-1,3-dioxolan-4-yl]ethyl]cyclohexen-1-yl]non-2-en-1-one |
|---|---|
| PubChem CID | 10690960 |
| Molecular Formula | C24H40O3 |
| Molecular Weight | 376.58 g/mol |
| Exact Mass | 376.30 |
| IUPAC Name | (E)-1-[2-[2-[(4S)-2,2-diethyl-1,3-dioxolan-4-yl]ethyl]cyclohexen-1-yl]non-2-en-1-one |
| SMILES | CCCCCC/C=C/C(=O)C1=C(CC[C@H]2COC(CC)(CC)O2)CCCC1 |
| InChI | InChI=1S/C24H40O3/c1-4-7-8-9-10-11-16-23(25)22-15-13-12-14-20(22)17-18-21-19-26-24(5-2,6-3)27-21/h11,16,21H,4-10,12-15,17-19H2,1-3H3/b16-11+/t21-/m0/s1 |
| InChIKey | NPJBJXUBFLTNBQ-HZBHDWBUSA-N |
| XLogP | 6.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.58 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|