C18H17Cl2N3O2 — CID 10691032
methyl (2R,4R)-2,4-bis(2-chloro-3-pyridinyl)-6-methyl-1,2,3,4-tetrahydropyridine-5-carboxylate (PubChem CID 10691032) has the molecular formula C18H17Cl2N3O2 and a molecular weight of 378.26 g/mol. Its IUPAC name is methyl (2R,4R)-2,4-bis(2-chloro-3-pyridinyl)-6-methyl-1,2,3,4-tetrahydropyridine-5-carboxylate.
| Compound Name | methyl (2R,4R)-2,4-bis(2-chloro-3-pyridinyl)-6-methyl-1,2,3,4-tetrahydropyridine-5-carboxylate |
|---|---|
| PubChem CID | 10691032 |
| Molecular Formula | C18H17Cl2N3O2 |
| Molecular Weight | 378.26 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | methyl (2R,4R)-2,4-bis(2-chloro-3-pyridinyl)-6-methyl-1,2,3,4-tetrahydropyridine-5-carboxylate |
| SMILES | COC(=O)C1=C(C)N[C@@H](c2cccnc2Cl)C[C@H]1c1cccnc1Cl |
| InChI | InChI=1S/C18H17Cl2N3O2/c1-10-15(18(24)25-2)13(11-5-3-7-21-16(11)19)9-14(23-10)12-6-4-8-22-17(12)20/h3-8,13-14,23H,9H2,1-2H3/t13-,14+/m0/s1 |
| InChIKey | VEOXSYVSHURYRC-UONOGXRCSA-N |
| XLogP | 4.05 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.26 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|