C13H18N2O2 — CID 106913294
3-[4-(propylaminomethyl)phenyl]-1,3-oxazolidin-2-one (PubChem CID 106913294) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 3-[4-(propylaminomethyl)phenyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[4-(propylaminomethyl)phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 106913294 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 3-[4-(propylaminomethyl)phenyl]-1,3-oxazolidin-2-one |
| SMILES | CCCNCc1ccc(N2CCOC2=O)cc1 |
| InChI | InChI=1S/C13H18N2O2/c1-2-7-14-10-11-3-5-12(6-4-11)15-8-9-17-13(15)16/h3-6,14H,2,7-10H2,1H3 |
| InChIKey | LQIIAAPAQWTSCU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|