About 2-[3-(sulfamoylamino)phenyl]-1,3-dioxolane
2-[3-(sulfamoylamino)phenyl]-1,3-dioxolane (PubChem CID 106913594) has the molecular formula C9H12N2O4S
and a molecular weight of 244.27 g/mol. Its IUPAC name is 2-[3-(sulfamoylamino)phenyl]-1,3-dioxolane.
Molecular Properties
| Compound Name | 2-[3-(sulfamoylamino)phenyl]-1,3-dioxolane |
| PubChem CID | 106913594 |
| Molecular Formula | C9H12N2O4S |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 2-[3-(sulfamoylamino)phenyl]-1,3-dioxolane |
| SMILES | NS(=O)(=O)Nc1cccc(C2OCCO2)c1 |
| InChI | InChI=1S/C9H12N2O4S/c10-16(12,13)11-8-3-1-2-7(6-8)9-14-4-5-15-9/h1-3,6,9,11H,4-5H2,(H2,10,12,13) |
| InChIKey | PLOOQVOLRGXZMM-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3-(sulfamoylamino)phenyl]-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(sulfamoylamino)phenyl]-1,3-dioxolane?
The IUPAC name of 2-[3-(sulfamoylamino)phenyl]-1,3-dioxolane (CID 106913594) is 2-[3-(sulfamoylamino)phenyl]-1,3-dioxolane.
What is the SMILES notation for 2-[3-(sulfamoylamino)phenyl]-1,3-dioxolane?
The canonical SMILES for 2-[3-(sulfamoylamino)phenyl]-1,3-dioxolane is NS(=O)(=O)Nc1cccc(C2OCCO2)c1.
What is the InChIKey of 2-[3-(sulfamoylamino)phenyl]-1,3-dioxolane?
The InChIKey is PLOOQVOLRGXZMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O4S/c10-16(12,13)11-8-3-1-2-7(6-8)9-14-4-5-15-9/h1-3,6,9,11H,4-5H2,(H2,10,12,13).
What are the key properties of 2-[3-(sulfamoylamino)phenyl]-1,3-dioxolane?
2-[3-(sulfamoylamino)phenyl]-1,3-dioxolane has a molecular weight of 244.27 g/mol, XLogP of 0.35, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(sulfamoylamino)phenyl]-1,3-dioxolane is sourced from PubChem (CID 106913594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).