About 3-[(3-amino-1,5-dimethylpyrazol-4-yl)sulfonyl-methylamino]-N-methylpropanamide
3-[(3-amino-1,5-dimethylpyrazol-4-yl)sulfonyl-methylamino]-N-methylpropanamide (PubChem CID 106913926) has the molecular formula C10H19N5O3S
and a molecular weight of 289.36 g/mol. Its IUPAC name is 3-[(3-amino-1,5-dimethylpyrazol-4-yl)sulfonyl-methylamino]-N-methylpropanamide.
Molecular Properties
| Compound Name | 3-[(3-amino-1,5-dimethylpyrazol-4-yl)sulfonyl-methylamino]-N-methylpropanamide |
| PubChem CID | 106913926 |
| Molecular Formula | C10H19N5O3S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 3-[(3-amino-1,5-dimethylpyrazol-4-yl)sulfonyl-methylamino]-N-methylpropanamide |
| SMILES | CNC(=O)CCN(C)S(=O)(=O)c1c(N)nn(C)c1C |
| InChI | InChI=1S/C10H19N5O3S/c1-7-9(10(11)13-15(7)4)19(17,18)14(3)6-5-8(16)12-2/h5-6H2,1-4H3,(H2,11,13)(H,12,16) |
| InChIKey | WHKKAWBIGMBCKD-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 110.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(3-amino-1,5-dimethylpyrazol-4-yl)sulfonyl-methylamino]-N-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-amino-1,5-dimethylpyrazol-4-yl)sulfonyl-methylamino]-N-methylpropanamide?
The IUPAC name of 3-[(3-amino-1,5-dimethylpyrazol-4-yl)sulfonyl-methylamino]-N-methylpropanamide (CID 106913926) is 3-[(3-amino-1,5-dimethylpyrazol-4-yl)sulfonyl-methylamino]-N-methylpropanamide.
What is the SMILES notation for 3-[(3-amino-1,5-dimethylpyrazol-4-yl)sulfonyl-methylamino]-N-methylpropanamide?
The canonical SMILES for 3-[(3-amino-1,5-dimethylpyrazol-4-yl)sulfonyl-methylamino]-N-methylpropanamide is CNC(=O)CCN(C)S(=O)(=O)c1c(N)nn(C)c1C.
What is the InChIKey of 3-[(3-amino-1,5-dimethylpyrazol-4-yl)sulfonyl-methylamino]-N-methylpropanamide?
The InChIKey is WHKKAWBIGMBCKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N5O3S/c1-7-9(10(11)13-15(7)4)19(17,18)14(3)6-5-8(16)12-2/h5-6H2,1-4H3,(H2,11,13)(H,12,16).
What are the key properties of 3-[(3-amino-1,5-dimethylpyrazol-4-yl)sulfonyl-methylamino]-N-methylpropanamide?
3-[(3-amino-1,5-dimethylpyrazol-4-yl)sulfonyl-methylamino]-N-methylpropanamide has a molecular weight of 289.36 g/mol, XLogP of -0.93, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-amino-1,5-dimethylpyrazol-4-yl)sulfonyl-methylamino]-N-methylpropanamide is sourced from PubChem (CID 106913926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).