About 3-[[2-amino-1-(5-methylfuran-2-yl)butyl]-methylamino]-N,2-dimethylpropanamide
3-[[2-amino-1-(5-methylfuran-2-yl)butyl]-methylamino]-N,2-dimethylpropanamide (PubChem CID 106914720) has the molecular formula C15H27N3O2
and a molecular weight of 281.40 g/mol. Its IUPAC name is 3-[[2-amino-1-(5-methylfuran-2-yl)butyl]-methylamino]-N,2-dimethylpropanamide.
Molecular Properties
| Compound Name | 3-[[2-amino-1-(5-methylfuran-2-yl)butyl]-methylamino]-N,2-dimethylpropanamide |
| PubChem CID | 106914720 |
| Molecular Formula | C15H27N3O2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | 3-[[2-amino-1-(5-methylfuran-2-yl)butyl]-methylamino]-N,2-dimethylpropanamide |
| SMILES | CCC(N)C(c1ccc(C)o1)N(C)CC(C)C(=O)NC |
| InChI | InChI=1S/C15H27N3O2/c1-6-12(16)14(13-8-7-11(3)20-13)18(5)9-10(2)15(19)17-4/h7-8,10,12,14H,6,9,16H2,1-5H3,(H,17,19) |
| InChIKey | QCBRVAJEDYZMHQ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[[2-amino-1-(5-methylfuran-2-yl)butyl]-methylamino]-N,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2-amino-1-(5-methylfuran-2-yl)butyl]-methylamino]-N,2-dimethylpropanamide?
The IUPAC name of 3-[[2-amino-1-(5-methylfuran-2-yl)butyl]-methylamino]-N,2-dimethylpropanamide (CID 106914720) is 3-[[2-amino-1-(5-methylfuran-2-yl)butyl]-methylamino]-N,2-dimethylpropanamide.
What is the SMILES notation for 3-[[2-amino-1-(5-methylfuran-2-yl)butyl]-methylamino]-N,2-dimethylpropanamide?
The canonical SMILES for 3-[[2-amino-1-(5-methylfuran-2-yl)butyl]-methylamino]-N,2-dimethylpropanamide is CCC(N)C(c1ccc(C)o1)N(C)CC(C)C(=O)NC.
What is the InChIKey of 3-[[2-amino-1-(5-methylfuran-2-yl)butyl]-methylamino]-N,2-dimethylpropanamide?
The InChIKey is QCBRVAJEDYZMHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27N3O2/c1-6-12(16)14(13-8-7-11(3)20-13)18(5)9-10(2)15(19)17-4/h7-8,10,12,14H,6,9,16H2,1-5H3,(H,17,19).
What are the key properties of 3-[[2-amino-1-(5-methylfuran-2-yl)butyl]-methylamino]-N,2-dimethylpropanamide?
3-[[2-amino-1-(5-methylfuran-2-yl)butyl]-methylamino]-N,2-dimethylpropanamide has a molecular weight of 281.40 g/mol, XLogP of 1.68, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-amino-1-(5-methylfuran-2-yl)butyl]-methylamino]-N,2-dimethylpropanamide is sourced from PubChem (CID 106914720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).