C11H14N4O — CID 106915472
3-[(2-cyano-3-pyridinyl)-methylamino]-N-methylpropanamide (PubChem CID 106915472) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is 3-[(2-cyano-3-pyridinyl)-methylamino]-N-methylpropanamide.
| Compound Name | 3-[(2-cyano-3-pyridinyl)-methylamino]-N-methylpropanamide |
|---|---|
| PubChem CID | 106915472 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 3-[(2-cyano-3-pyridinyl)-methylamino]-N-methylpropanamide |
| SMILES | CNC(=O)CCN(C)c1cccnc1C#N |
| InChI | InChI=1S/C11H14N4O/c1-13-11(16)5-7-15(2)10-4-3-6-14-9(10)8-12/h3-4,6H,5,7H2,1-2H3,(H,13,16) |
| InChIKey | XBKWEBOUWIAJPM-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |