C10H24N2S — CID 106915866
N-(2-ethylsulfanylethyl)-N,N',2-trimethylpropane-1,3-diamine (PubChem CID 106915866) has the molecular formula C10H24N2S and a molecular weight of 204.38 g/mol. Its IUPAC name is N-(2-ethylsulfanylethyl)-N,N',2-trimethylpropane-1,3-diamine.
| Compound Name | N-(2-ethylsulfanylethyl)-N,N',2-trimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 106915866 |
| Molecular Formula | C10H24N2S |
| Molecular Weight | 204.38 g/mol |
| Exact Mass | 204.17 |
| IUPAC Name | N-(2-ethylsulfanylethyl)-N,N',2-trimethylpropane-1,3-diamine |
| SMILES | CCSCCN(C)CC(C)CNC |
| InChI | InChI=1S/C10H24N2S/c1-5-13-7-6-12(4)9-10(2)8-11-3/h10-11H,5-9H2,1-4H3 |
| InChIKey | KZIJPIUTQRRMFS-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.38 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|