C18H14F5NOS — CID 10691607
1-[1-(2,3,4,5,6-pentafluorophenyl)ethyl]-5-phenylsulfanylpyrrolidin-2-one (PubChem CID 10691607) has the molecular formula C18H14F5NOS and a molecular weight of 387.37 g/mol. Its IUPAC name is 1-[1-(2,3,4,5,6-pentafluorophenyl)ethyl]-5-phenylsulfanylpyrrolidin-2-one.
| Compound Name | 1-[1-(2,3,4,5,6-pentafluorophenyl)ethyl]-5-phenylsulfanylpyrrolidin-2-one |
|---|---|
| PubChem CID | 10691607 |
| Molecular Formula | C18H14F5NOS |
| Molecular Weight | 387.37 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | 1-[1-(2,3,4,5,6-pentafluorophenyl)ethyl]-5-phenylsulfanylpyrrolidin-2-one |
| SMILES | CC(c1c(F)c(F)c(F)c(F)c1F)N1C(=O)CCC1Sc1ccccc1 |
| InChI | InChI=1S/C18H14F5NOS/c1-9(13-14(19)16(21)18(23)17(22)15(13)20)24-11(25)7-8-12(24)26-10-5-3-2-4-6-10/h2-6,9,12H,7-8H2,1H3 |
| InChIKey | COBBWALAKYJHLZ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.37 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|