C14H21ClN2O2 — CID 106916395
3-[3-chloro-4-(1-hydroxyethyl)-N-methylanilino]-N,2-dimethylpropanamide (PubChem CID 106916395) has the molecular formula C14H21ClN2O2 and a molecular weight of 284.79 g/mol. Its IUPAC name is 3-[3-chloro-4-(1-hydroxyethyl)-N-methylanilino]-N,2-dimethylpropanamide.
| Compound Name | 3-[3-chloro-4-(1-hydroxyethyl)-N-methylanilino]-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 106916395 |
| Molecular Formula | C14H21ClN2O2 |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 3-[3-chloro-4-(1-hydroxyethyl)-N-methylanilino]-N,2-dimethylpropanamide |
| SMILES | CNC(=O)C(C)CN(C)c1ccc(C(C)O)c(Cl)c1 |
| InChI | InChI=1S/C14H21ClN2O2/c1-9(14(19)16-3)8-17(4)11-5-6-12(10(2)18)13(15)7-11/h5-7,9-10,18H,8H2,1-4H3,(H,16,19) |
| InChIKey | IOTLZABRLGAGCQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|