C16H28N4O — CID 106916830
N,2-dimethyl-3-[methyl-[3-methyl-5-(propylaminomethyl)-2-pyridinyl]amino]propanamide (PubChem CID 106916830) has the molecular formula C16H28N4O and a molecular weight of 292.43 g/mol. Its IUPAC name is N,2-dimethyl-3-[methyl-[3-methyl-5-(propylaminomethyl)-2-pyridinyl]amino]propanamide.
| Compound Name | N,2-dimethyl-3-[methyl-[3-methyl-5-(propylaminomethyl)-2-pyridinyl]amino]propanamide |
|---|---|
| PubChem CID | 106916830 |
| Molecular Formula | C16H28N4O |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.23 |
| IUPAC Name | N,2-dimethyl-3-[methyl-[3-methyl-5-(propylaminomethyl)-2-pyridinyl]amino]propanamide |
| SMILES | CCCNCc1cnc(N(C)CC(C)C(=O)NC)c(C)c1 |
| InChI | InChI=1S/C16H28N4O/c1-6-7-18-9-14-8-12(2)15(19-10-14)20(5)11-13(3)16(21)17-4/h8,10,13,18H,6-7,9,11H2,1-5H3,(H,17,21) |
| InChIKey | HPCROTDWCBFSDQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|