C12H23N3O4 — CID 106917240
3-[ethyl-[methyl-[2-methyl-3-(methylamino)-3-oxopropyl]carbamoyl]amino]propanoic acid (PubChem CID 106917240) has the molecular formula C12H23N3O4 and a molecular weight of 273.33 g/mol. Its IUPAC name is 3-[ethyl-[methyl-[2-methyl-3-(methylamino)-3-oxopropyl]carbamoyl]amino]propanoic acid.
| Compound Name | 3-[ethyl-[methyl-[2-methyl-3-(methylamino)-3-oxopropyl]carbamoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 106917240 |
| Molecular Formula | C12H23N3O4 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 3-[ethyl-[methyl-[2-methyl-3-(methylamino)-3-oxopropyl]carbamoyl]amino]propanoic acid |
| SMILES | CCN(CCC(=O)O)C(=O)N(C)CC(C)C(=O)NC |
| InChI | InChI=1S/C12H23N3O4/c1-5-15(7-6-10(16)17)12(19)14(4)8-9(2)11(18)13-3/h9H,5-8H2,1-4H3,(H,13,18)(H,16,17) |
| InChIKey | WUUYCSANVJJTQQ-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |