C13H23N5O — CID 106918543
N-methyl-3-[methyl-[6-(methylamino)-5-propan-2-ylpyrimidin-4-yl]amino]propanamide (PubChem CID 106918543) has the molecular formula C13H23N5O and a molecular weight of 265.36 g/mol. Its IUPAC name is N-methyl-3-[methyl-[6-(methylamino)-5-propan-2-ylpyrimidin-4-yl]amino]propanamide.
| Compound Name | N-methyl-3-[methyl-[6-(methylamino)-5-propan-2-ylpyrimidin-4-yl]amino]propanamide |
|---|---|
| PubChem CID | 106918543 |
| Molecular Formula | C13H23N5O |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | N-methyl-3-[methyl-[6-(methylamino)-5-propan-2-ylpyrimidin-4-yl]amino]propanamide |
| SMILES | CNC(=O)CCN(C)c1ncnc(NC)c1C(C)C |
| InChI | InChI=1S/C13H23N5O/c1-9(2)11-12(15-4)16-8-17-13(11)18(5)7-6-10(19)14-3/h8-9H,6-7H2,1-5H3,(H,14,19)(H,15,16,17) |
| InChIKey | KAPCAZGUXZIBHK-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |