C11H18N2O2S — CID 106919113
4-(aminomethyl)-N-ethyl-N,3-dimethylbenzenesulfonamide (PubChem CID 106919113) has the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. Its IUPAC name is 4-(aminomethyl)-N-ethyl-N,3-dimethylbenzenesulfonamide.
| Compound Name | 4-(aminomethyl)-N-ethyl-N,3-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 106919113 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 4-(aminomethyl)-N-ethyl-N,3-dimethylbenzenesulfonamide |
| SMILES | CCN(C)S(=O)(=O)c1ccc(CN)c(C)c1 |
| InChI | InChI=1S/C11H18N2O2S/c1-4-13(3)16(14,15)11-6-5-10(8-12)9(2)7-11/h5-7H,4,8,12H2,1-3H3 |
| InChIKey | CKKSVMMVERDSRR-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |