C22H19NO6 — CID 10691956
(1S,12R)-15,16-dimethoxy-20-prop-2-enyl-5,7-dioxa-20-azapentacyclo[10.8.0.02,10.04,8.013,18]icosa-2,4(8),9,13,15,17-hexaene-11,19-dione (PubChem CID 10691956) has the molecular formula C22H19NO6 and a molecular weight of 393.40 g/mol. Its IUPAC name is (1S,12R)-15,16-dimethoxy-20-prop-2-enyl-5,7-dioxa-20-azapentacyclo[10.8.0.02,10.04,8.013,18]icosa-2,4(8),9,13,15,17-hexaene-11,19-dione.
| Compound Name | (1S,12R)-15,16-dimethoxy-20-prop-2-enyl-5,7-dioxa-20-azapentacyclo[10.8.0.02,10.04,8.013,18]icosa-2,4(8),9,13,15,17-hexaene-11,19-dione |
|---|---|
| PubChem CID | 10691956 |
| Molecular Formula | C22H19NO6 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | (1S,12R)-15,16-dimethoxy-20-prop-2-enyl-5,7-dioxa-20-azapentacyclo[10.8.0.02,10.04,8.013,18]icosa-2,4(8),9,13,15,17-hexaene-11,19-dione |
| SMILES | C=CCN1C(=O)c2cc(OC)c(OC)cc2[C@H]2C(=O)c3cc4c(cc3[C@H]21)OCO4 |
| InChI | InChI=1S/C22H19NO6/c1-4-5-23-20-12-7-17-18(29-10-28-17)8-13(12)21(24)19(20)11-6-15(26-2)16(27-3)9-14(11)22(23)25/h4,6-9,19-20H,1,5,10H2,2-3H3/t19-,20-/m1/s1 |
| InChIKey | VUSLGSIKCKVEDQ-WOJBJXKFSA-N |
| XLogP | 3.10 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|