C21H23N5O3 — CID 10691966
[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-phenylmethanone (PubChem CID 10691966) has the molecular formula C21H23N5O3 and a molecular weight of 393.45 g/mol. Its IUPAC name is [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-phenylmethanone.
| Compound Name | [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 10691966 |
| Molecular Formula | C21H23N5O3 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-phenylmethanone |
| SMILES | COc1cc2nc(N3CCN(C(=O)c4ccccc4)CC3)nc(N)c2cc1OC |
| InChI | InChI=1S/C21H23N5O3/c1-28-17-12-15-16(13-18(17)29-2)23-21(24-19(15)22)26-10-8-25(9-11-26)20(27)14-6-4-3-5-7-14/h3-7,12-13H,8-11H2,1-2H3,(H2,22,23,24) |
| InChIKey | ZZSVTGUBKHVPCL-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |