C12H22CuO14 — CID 10692
copper bis((2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate) (PubChem CID 10692) has the molecular formula C12H22CuO14 and a molecular weight of 453.84 g/mol. Its IUPAC name is copper bis((2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate).
| Compound Name | copper bis((2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate) |
|---|---|
| PubChem CID | 10692 |
| Molecular Formula | C12H22CuO14 |
| Molecular Weight | 453.84 g/mol |
| Exact Mass | 453.03 |
| IUPAC Name | copper bis((2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate) |
| SMILES | O=C([O-])[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.O=C([O-])[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.[Cu+2] |
| InChI | InChI=1S/2C6H12O7.Cu/c2*7-1-2(8)3(9)4(10)5(11)6(12)13;/h2*2-5,7-11H,1H2,(H,12,13);/q;;+2/p-2/t2*2-,3-,4+,5-;/m11./s1 |
| InChIKey | OCUCCJIRFHNWBP-IYEMJOQQSA-L |
| XLogP | -9.66 |
| TPSA | 282.56 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.84 |
| LogP ≤ 5 | -9.66 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 14 |