C12H18N2O3S3 — CID 106920372
4-(2-ethylsulfinylethylsulfamoyl)-2-methylbenzenecarbothioamide (PubChem CID 106920372) has the molecular formula C12H18N2O3S3 and a molecular weight of 334.49 g/mol. Its IUPAC name is 4-(2-ethylsulfinylethylsulfamoyl)-2-methylbenzenecarbothioamide.
| Compound Name | 4-(2-ethylsulfinylethylsulfamoyl)-2-methylbenzenecarbothioamide |
|---|---|
| PubChem CID | 106920372 |
| Molecular Formula | C12H18N2O3S3 |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 4-(2-ethylsulfinylethylsulfamoyl)-2-methylbenzenecarbothioamide |
| SMILES | CCS(=O)CCNS(=O)(=O)c1ccc(C(N)=S)c(C)c1 |
| InChI | InChI=1S/C12H18N2O3S3/c1-3-19(15)7-6-14-20(16,17)10-4-5-11(12(13)18)9(2)8-10/h4-5,8,14H,3,6-7H2,1-2H3,(H2,13,18) |
| InChIKey | SZLOKTXIDWALDW-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|