C8H9BrF3NOS — CID 106921037
2-(2-bromo-3,3,3-trifluoropropyl)sulfanyl-4,5-dimethyl-1,3-oxazole (PubChem CID 106921037) has the molecular formula C8H9BrF3NOS and a molecular weight of 304.13 g/mol. Its IUPAC name is 2-(2-bromo-3,3,3-trifluoropropyl)sulfanyl-4,5-dimethyl-1,3-oxazole.
| Compound Name | 2-(2-bromo-3,3,3-trifluoropropyl)sulfanyl-4,5-dimethyl-1,3-oxazole |
|---|---|
| PubChem CID | 106921037 |
| Molecular Formula | C8H9BrF3NOS |
| Molecular Weight | 304.13 g/mol |
| Exact Mass | 302.95 |
| IUPAC Name | 2-(2-bromo-3,3,3-trifluoropropyl)sulfanyl-4,5-dimethyl-1,3-oxazole |
| SMILES | Cc1nc(SCC(Br)C(F)(F)F)oc1C |
| InChI | InChI=1S/C8H9BrF3NOS/c1-4-5(2)14-7(13-4)15-3-6(9)8(10,11)12/h6H,3H2,1-2H3 |
| InChIKey | HVZIXTYLRIRDEO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.13 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|