C8H11F3N2OS — CID 106921938
1,1,1-trifluoro-2-(1,3-oxazol-2-ylsulfanyl)pentan-3-amine (PubChem CID 106921938) has the molecular formula C8H11F3N2OS and a molecular weight of 240.25 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-(1,3-oxazol-2-ylsulfanyl)pentan-3-amine.
| Compound Name | 1,1,1-trifluoro-2-(1,3-oxazol-2-ylsulfanyl)pentan-3-amine |
|---|---|
| PubChem CID | 106921938 |
| Molecular Formula | C8H11F3N2OS |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 1,1,1-trifluoro-2-(1,3-oxazol-2-ylsulfanyl)pentan-3-amine |
| SMILES | CCC(N)C(Sc1ncco1)C(F)(F)F |
| InChI | InChI=1S/C8H11F3N2OS/c1-2-5(12)6(8(9,10)11)15-7-13-3-4-14-7/h3-6H,2,12H2,1H3 |
| InChIKey | QNLVOUFDOQRCAZ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |