About 3-fluoro-2-[(4-methyl-1,3-oxazol-2-yl)sulfanylmethyl]aniline
3-fluoro-2-[(4-methyl-1,3-oxazol-2-yl)sulfanylmethyl]aniline (PubChem CID 106921977) has the molecular formula C11H11FN2OS
and a molecular weight of 238.29 g/mol. Its IUPAC name is 3-fluoro-2-[(4-methyl-1,3-oxazol-2-yl)sulfanylmethyl]aniline.
Molecular Properties
| Compound Name | 3-fluoro-2-[(4-methyl-1,3-oxazol-2-yl)sulfanylmethyl]aniline |
| PubChem CID | 106921977 |
| Molecular Formula | C11H11FN2OS |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 3-fluoro-2-[(4-methyl-1,3-oxazol-2-yl)sulfanylmethyl]aniline |
| SMILES | Cc1coc(SCc2c(N)cccc2F)n1 |
| InChI | InChI=1S/C11H11FN2OS/c1-7-5-15-11(14-7)16-6-8-9(12)3-2-4-10(8)13/h2-5H,6,13H2,1H3 |
| InChIKey | JKQWRYQVQOKJQM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-2-[(4-methyl-1,3-oxazol-2-yl)sulfanylmethyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-2-[(4-methyl-1,3-oxazol-2-yl)sulfanylmethyl]aniline?
The IUPAC name of 3-fluoro-2-[(4-methyl-1,3-oxazol-2-yl)sulfanylmethyl]aniline (CID 106921977) is 3-fluoro-2-[(4-methyl-1,3-oxazol-2-yl)sulfanylmethyl]aniline.
What is the SMILES notation for 3-fluoro-2-[(4-methyl-1,3-oxazol-2-yl)sulfanylmethyl]aniline?
The canonical SMILES for 3-fluoro-2-[(4-methyl-1,3-oxazol-2-yl)sulfanylmethyl]aniline is Cc1coc(SCc2c(N)cccc2F)n1.
What is the InChIKey of 3-fluoro-2-[(4-methyl-1,3-oxazol-2-yl)sulfanylmethyl]aniline?
The InChIKey is JKQWRYQVQOKJQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11FN2OS/c1-7-5-15-11(14-7)16-6-8-9(12)3-2-4-10(8)13/h2-5H,6,13H2,1H3.
What are the key properties of 3-fluoro-2-[(4-methyl-1,3-oxazol-2-yl)sulfanylmethyl]aniline?
3-fluoro-2-[(4-methyl-1,3-oxazol-2-yl)sulfanylmethyl]aniline has a molecular weight of 238.29 g/mol, XLogP of 3.00, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-2-[(4-methyl-1,3-oxazol-2-yl)sulfanylmethyl]aniline is sourced from PubChem (CID 106921977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).