C8H13N3OS — CID 106922932
2-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]butanimidamide (PubChem CID 106922932) has the molecular formula C8H13N3OS and a molecular weight of 199.28 g/mol. Its IUPAC name is 2-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]butanimidamide.
| Compound Name | 2-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]butanimidamide |
|---|---|
| PubChem CID | 106922932 |
| Molecular Formula | C8H13N3OS |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 2-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]butanimidamide |
| SMILES | [H]/N=C(\N)C(CC)Sc1nc(C)co1 |
| InChI | InChI=1S/C8H13N3OS/c1-3-6(7(9)10)13-8-11-5(2)4-12-8/h4,6H,3H2,1-2H3,(H3,9,10) |
| InChIKey | XLNGNKMXSIAEOI-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 75.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|