About 1-[2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-5-fluorophenyl]-N-ethylethanamine
1-[2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-5-fluorophenyl]-N-ethylethanamine (PubChem CID 106923320) has the molecular formula C15H19FN2OS
and a molecular weight of 294.40 g/mol. Its IUPAC name is 1-[2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-5-fluorophenyl]-N-ethylethanamine.
Molecular Properties
| Compound Name | 1-[2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-5-fluorophenyl]-N-ethylethanamine |
| PubChem CID | 106923320 |
| Molecular Formula | C15H19FN2OS |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 1-[2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-5-fluorophenyl]-N-ethylethanamine |
| SMILES | CCNC(C)c1cc(F)ccc1Sc1nc(C)c(C)o1 |
| InChI | InChI=1S/C15H19FN2OS/c1-5-17-10(3)13-8-12(16)6-7-14(13)20-15-18-9(2)11(4)19-15/h6-8,10,17H,5H2,1-4H3 |
| InChIKey | LPZGCFMWTLGJEA-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-5-fluorophenyl]-N-ethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-5-fluorophenyl]-N-ethylethanamine?
The IUPAC name of 1-[2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-5-fluorophenyl]-N-ethylethanamine (CID 106923320) is 1-[2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-5-fluorophenyl]-N-ethylethanamine.
What is the SMILES notation for 1-[2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-5-fluorophenyl]-N-ethylethanamine?
The canonical SMILES for 1-[2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-5-fluorophenyl]-N-ethylethanamine is CCNC(C)c1cc(F)ccc1Sc1nc(C)c(C)o1.
What is the InChIKey of 1-[2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-5-fluorophenyl]-N-ethylethanamine?
The InChIKey is LPZGCFMWTLGJEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19FN2OS/c1-5-17-10(3)13-8-12(16)6-7-14(13)20-15-18-9(2)11(4)19-15/h6-8,10,17H,5H2,1-4H3.
What are the key properties of 1-[2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-5-fluorophenyl]-N-ethylethanamine?
1-[2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-5-fluorophenyl]-N-ethylethanamine has a molecular weight of 294.40 g/mol, XLogP of 4.25, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-5-fluorophenyl]-N-ethylethanamine is sourced from PubChem (CID 106923320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).