About [3-(1,3-oxazol-2-ylsulfanyl)pyridazin-4-yl]methanamine
[3-(1,3-oxazol-2-ylsulfanyl)pyridazin-4-yl]methanamine (PubChem CID 106923672) has the molecular formula C8H8N4OS
and a molecular weight of 208.25 g/mol. Its IUPAC name is [3-(1,3-oxazol-2-ylsulfanyl)pyridazin-4-yl]methanamine.
Molecular Properties
| Compound Name | [3-(1,3-oxazol-2-ylsulfanyl)pyridazin-4-yl]methanamine |
| PubChem CID | 106923672 |
| Molecular Formula | C8H8N4OS |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | [3-(1,3-oxazol-2-ylsulfanyl)pyridazin-4-yl]methanamine |
| SMILES | NCc1ccnnc1Sc1ncco1 |
| InChI | InChI=1S/C8H8N4OS/c9-5-6-1-2-11-12-7(6)14-8-10-3-4-13-8/h1-4H,5,9H2 |
| InChIKey | KZQIBDOAJYVLPU-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [3-(1,3-oxazol-2-ylsulfanyl)pyridazin-4-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1,3-oxazol-2-ylsulfanyl)pyridazin-4-yl]methanamine?
The IUPAC name of [3-(1,3-oxazol-2-ylsulfanyl)pyridazin-4-yl]methanamine (CID 106923672) is [3-(1,3-oxazol-2-ylsulfanyl)pyridazin-4-yl]methanamine.
What is the SMILES notation for [3-(1,3-oxazol-2-ylsulfanyl)pyridazin-4-yl]methanamine?
The canonical SMILES for [3-(1,3-oxazol-2-ylsulfanyl)pyridazin-4-yl]methanamine is NCc1ccnnc1Sc1ncco1.
What is the InChIKey of [3-(1,3-oxazol-2-ylsulfanyl)pyridazin-4-yl]methanamine?
The InChIKey is KZQIBDOAJYVLPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4OS/c9-5-6-1-2-11-12-7(6)14-8-10-3-4-13-8/h1-4H,5,9H2.
What are the key properties of [3-(1,3-oxazol-2-ylsulfanyl)pyridazin-4-yl]methanamine?
[3-(1,3-oxazol-2-ylsulfanyl)pyridazin-4-yl]methanamine has a molecular weight of 208.25 g/mol, XLogP of 1.07, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1,3-oxazol-2-ylsulfanyl)pyridazin-4-yl]methanamine is sourced from PubChem (CID 106923672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).