About [4-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]-2-(trifluoromethyl)phenyl]methanamine
[4-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]-2-(trifluoromethyl)phenyl]methanamine (PubChem CID 106923695) has the molecular formula C12H11F3N2OS
and a molecular weight of 288.29 g/mol. Its IUPAC name is [4-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]-2-(trifluoromethyl)phenyl]methanamine.
Molecular Properties
| Compound Name | [4-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]-2-(trifluoromethyl)phenyl]methanamine |
| PubChem CID | 106923695 |
| Molecular Formula | C12H11F3N2OS |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | [4-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]-2-(trifluoromethyl)phenyl]methanamine |
| SMILES | Cc1coc(Sc2ccc(CN)c(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C12H11F3N2OS/c1-7-6-18-11(17-7)19-9-3-2-8(5-16)10(4-9)12(13,14)15/h2-4,6H,5,16H2,1H3 |
| InChIKey | CLBHGYJPPRLNQX-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]-2-(trifluoromethyl)phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]-2-(trifluoromethyl)phenyl]methanamine?
The IUPAC name of [4-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]-2-(trifluoromethyl)phenyl]methanamine (CID 106923695) is [4-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]-2-(trifluoromethyl)phenyl]methanamine.
What is the SMILES notation for [4-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]-2-(trifluoromethyl)phenyl]methanamine?
The canonical SMILES for [4-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]-2-(trifluoromethyl)phenyl]methanamine is Cc1coc(Sc2ccc(CN)c(C(F)(F)F)c2)n1.
What is the InChIKey of [4-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]-2-(trifluoromethyl)phenyl]methanamine?
The InChIKey is CLBHGYJPPRLNQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11F3N2OS/c1-7-6-18-11(17-7)19-9-3-2-8(5-16)10(4-9)12(13,14)15/h2-4,6H,5,16H2,1H3.
What are the key properties of [4-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]-2-(trifluoromethyl)phenyl]methanamine?
[4-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]-2-(trifluoromethyl)phenyl]methanamine has a molecular weight of 288.29 g/mol, XLogP of 3.61, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]-2-(trifluoromethyl)phenyl]methanamine is sourced from PubChem (CID 106923695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).