C24H32O3S — CID 10692391
[(3E,5Z,7E,9R,10R,11E)-10-methoxy-3,7,9,11-tetramethyltrideca-1,3,5,7,11-pentaen-6-yl]sulfonylbenzene (PubChem CID 10692391) has the molecular formula C24H32O3S and a molecular weight of 400.58 g/mol. Its IUPAC name is [(3E,5Z,7E,9R,10R,11E)-10-methoxy-3,7,9,11-tetramethyltrideca-1,3,5,7,11-pentaen-6-yl]sulfonylbenzene.
| Compound Name | [(3E,5Z,7E,9R,10R,11E)-10-methoxy-3,7,9,11-tetramethyltrideca-1,3,5,7,11-pentaen-6-yl]sulfonylbenzene |
|---|---|
| PubChem CID | 10692391 |
| Molecular Formula | C24H32O3S |
| Molecular Weight | 400.58 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | [(3E,5Z,7E,9R,10R,11E)-10-methoxy-3,7,9,11-tetramethyltrideca-1,3,5,7,11-pentaen-6-yl]sulfonylbenzene |
| SMILES | C=C/C(C)=C/C=C(C(/C)=C/[C@@H](C)[C@@H](OC)/C(C)=C/C)\S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H32O3S/c1-8-18(3)15-16-23(28(25,26)22-13-11-10-12-14-22)20(5)17-21(6)24(27-7)19(4)9-2/h8-17,21,24H,1H2,2-7H3/b18-15+,19-9+,20-17+,23-16-/t21-,24+/m1/s1 |
| InChIKey | SJUBGPFMNKCQEU-AFWWHMPSSA-N |
| XLogP | 6.04 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.58 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|