About 2-amino-5-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]benzamide
2-amino-5-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]benzamide (PubChem CID 106924162) has the molecular formula C12H13N3O2S
and a molecular weight of 263.32 g/mol. Its IUPAC name is 2-amino-5-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]benzamide.
Molecular Properties
| Compound Name | 2-amino-5-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]benzamide |
| PubChem CID | 106924162 |
| Molecular Formula | C12H13N3O2S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 2-amino-5-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]benzamide |
| SMILES | Cc1nc(Sc2ccc(N)c(C(N)=O)c2)oc1C |
| InChI | InChI=1S/C12H13N3O2S/c1-6-7(2)17-12(15-6)18-8-3-4-10(13)9(5-8)11(14)16/h3-5H,13H2,1-2H3,(H2,14,16) |
| InChIKey | RCUFGNFGTNTEQN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-5-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]benzamide?
The IUPAC name of 2-amino-5-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]benzamide (CID 106924162) is 2-amino-5-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]benzamide.
What is the SMILES notation for 2-amino-5-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]benzamide?
The canonical SMILES for 2-amino-5-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]benzamide is Cc1nc(Sc2ccc(N)c(C(N)=O)c2)oc1C.
What is the InChIKey of 2-amino-5-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]benzamide?
The InChIKey is RCUFGNFGTNTEQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O2S/c1-6-7(2)17-12(15-6)18-8-3-4-10(13)9(5-8)11(14)16/h3-5H,13H2,1-2H3,(H2,14,16).
What are the key properties of 2-amino-5-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]benzamide?
2-amino-5-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]benzamide has a molecular weight of 263.32 g/mol, XLogP of 2.12, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]benzamide is sourced from PubChem (CID 106924162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).