About 5-chloro-4-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-1H-pyrimidin-6-one
5-chloro-4-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-1H-pyrimidin-6-one (PubChem CID 106924226) has the molecular formula C9H8ClN3O2S
and a molecular weight of 257.70 g/mol. Its IUPAC name is 5-chloro-4-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 5-chloro-4-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-1H-pyrimidin-6-one |
| PubChem CID | 106924226 |
| Molecular Formula | C9H8ClN3O2S |
| Molecular Weight | 257.70 g/mol |
| Exact Mass | 257.00 |
| IUPAC Name | 5-chloro-4-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-1H-pyrimidin-6-one |
| SMILES | Cc1nc(Sc2nc[nH]c(=O)c2Cl)oc1C |
| InChI | InChI=1S/C9H8ClN3O2S/c1-4-5(2)15-9(13-4)16-8-6(10)7(14)11-3-12-8/h3H,1-2H3,(H,11,12,14) |
| InChIKey | IJOUDTSFURYUPR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.70 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-chloro-4-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-4-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-1H-pyrimidin-6-one?
The IUPAC name of 5-chloro-4-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-1H-pyrimidin-6-one (CID 106924226) is 5-chloro-4-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-1H-pyrimidin-6-one.
What is the SMILES notation for 5-chloro-4-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-1H-pyrimidin-6-one?
The canonical SMILES for 5-chloro-4-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-1H-pyrimidin-6-one is Cc1nc(Sc2nc[nH]c(=O)c2Cl)oc1C.
What is the InChIKey of 5-chloro-4-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-1H-pyrimidin-6-one?
The InChIKey is IJOUDTSFURYUPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClN3O2S/c1-4-5(2)15-9(13-4)16-8-6(10)7(14)11-3-12-8/h3H,1-2H3,(H,11,12,14).
What are the key properties of 5-chloro-4-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-1H-pyrimidin-6-one?
5-chloro-4-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-1H-pyrimidin-6-one has a molecular weight of 257.70 g/mol, XLogP of 2.18, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-4-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-1H-pyrimidin-6-one is sourced from PubChem (CID 106924226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).