C12H13BFNO3S — CID 106924390
[5-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanylmethyl]-2-fluorophenyl]boronic acid (PubChem CID 106924390) has the molecular formula C12H13BFNO3S and a molecular weight of 281.12 g/mol. Its IUPAC name is [5-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanylmethyl]-2-fluorophenyl]boronic acid.
| Compound Name | [5-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanylmethyl]-2-fluorophenyl]boronic acid |
|---|---|
| PubChem CID | 106924390 |
| Molecular Formula | C12H13BFNO3S |
| Molecular Weight | 281.12 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | [5-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanylmethyl]-2-fluorophenyl]boronic acid |
| SMILES | Cc1nc(SCc2ccc(F)c(B(O)O)c2)oc1C |
| InChI | InChI=1S/C12H13BFNO3S/c1-7-8(2)18-12(15-7)19-6-9-3-4-11(14)10(5-9)13(16)17/h3-5,16-17H,6H2,1-2H3 |
| InChIKey | XXVMDRGSKAENHF-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.12 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|