C15H15NO3S — CID 106924439
4-[3-[2-(1,3-oxazol-2-ylsulfanyl)ethoxy]phenyl]but-3-yn-1-ol (PubChem CID 106924439) has the molecular formula C15H15NO3S and a molecular weight of 289.36 g/mol. Its IUPAC name is 4-[3-[2-(1,3-oxazol-2-ylsulfanyl)ethoxy]phenyl]but-3-yn-1-ol.
| Compound Name | 4-[3-[2-(1,3-oxazol-2-ylsulfanyl)ethoxy]phenyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 106924439 |
| Molecular Formula | C15H15NO3S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 4-[3-[2-(1,3-oxazol-2-ylsulfanyl)ethoxy]phenyl]but-3-yn-1-ol |
| SMILES | OCCC#Cc1cccc(OCCSc2ncco2)c1 |
| InChI | InChI=1S/C15H15NO3S/c17-8-2-1-4-13-5-3-6-14(12-13)18-10-11-20-15-16-7-9-19-15/h3,5-7,9,12,17H,2,8,10-11H2 |
| InChIKey | CPASWYOKNQAQKB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|