C13H20N2O3S — CID 106924995
2-(cyclopropylamino)-2-methyl-6-(1,3-oxazol-2-ylsulfanyl)hexanoic acid (PubChem CID 106924995) has the molecular formula C13H20N2O3S and a molecular weight of 284.38 g/mol. Its IUPAC name is 2-(cyclopropylamino)-2-methyl-6-(1,3-oxazol-2-ylsulfanyl)hexanoic acid.
| Compound Name | 2-(cyclopropylamino)-2-methyl-6-(1,3-oxazol-2-ylsulfanyl)hexanoic acid |
|---|---|
| PubChem CID | 106924995 |
| Molecular Formula | C13H20N2O3S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 2-(cyclopropylamino)-2-methyl-6-(1,3-oxazol-2-ylsulfanyl)hexanoic acid |
| SMILES | CC(CCCCSc1ncco1)(NC1CC1)C(=O)O |
| InChI | InChI=1S/C13H20N2O3S/c1-13(11(16)17,15-10-4-5-10)6-2-3-9-19-12-14-7-8-18-12/h7-8,10,15H,2-6,9H2,1H3,(H,16,17) |
| InChIKey | PBOOQMVRGSWOEO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|