C25H29N3O2 — CID 10692539
[3-[[4-(1-benzofuran-6-yl)piperazin-1-yl]methyl]phenyl]-piperidin-1-ylmethanone (PubChem CID 10692539) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is [3-[[4-(1-benzofuran-6-yl)piperazin-1-yl]methyl]phenyl]-piperidin-1-ylmethanone.
| Compound Name | [3-[[4-(1-benzofuran-6-yl)piperazin-1-yl]methyl]phenyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 10692539 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | [3-[[4-(1-benzofuran-6-yl)piperazin-1-yl]methyl]phenyl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1cccc(CN2CCN(c3ccc4ccoc4c3)CC2)c1)N1CCCCC1 |
| InChI | InChI=1S/C25H29N3O2/c29-25(28-10-2-1-3-11-28)22-6-4-5-20(17-22)19-26-12-14-27(15-13-26)23-8-7-21-9-16-30-24(21)18-23/h4-9,16-18H,1-3,10-15,19H2 |
| InChIKey | QTWVKTIFVJAWQC-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 39.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |