C11H11FN2OS — CID 106925735
2-fluoro-N-[2-(1,3-oxazol-2-ylsulfanyl)ethyl]aniline (PubChem CID 106925735) has the molecular formula C11H11FN2OS and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-fluoro-N-[2-(1,3-oxazol-2-ylsulfanyl)ethyl]aniline.
| Compound Name | 2-fluoro-N-[2-(1,3-oxazol-2-ylsulfanyl)ethyl]aniline |
|---|---|
| PubChem CID | 106925735 |
| Molecular Formula | C11H11FN2OS |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 2-fluoro-N-[2-(1,3-oxazol-2-ylsulfanyl)ethyl]aniline |
| SMILES | Fc1ccccc1NCCSc1ncco1 |
| InChI | InChI=1S/C11H11FN2OS/c12-9-3-1-2-4-10(9)13-6-8-16-11-14-5-7-15-11/h1-5,7,13H,6,8H2 |
| InChIKey | XFODYXBMYILGEM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|