About N-ethyl-2-(1,3-oxazol-2-ylsulfanyl)propan-1-amine
N-ethyl-2-(1,3-oxazol-2-ylsulfanyl)propan-1-amine (PubChem CID 106925805) has the molecular formula C8H14N2OS
and a molecular weight of 186.28 g/mol. Its IUPAC name is N-ethyl-2-(1,3-oxazol-2-ylsulfanyl)propan-1-amine.
Molecular Properties
| Compound Name | N-ethyl-2-(1,3-oxazol-2-ylsulfanyl)propan-1-amine |
| PubChem CID | 106925805 |
| Molecular Formula | C8H14N2OS |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | N-ethyl-2-(1,3-oxazol-2-ylsulfanyl)propan-1-amine |
| SMILES | CCNCC(C)Sc1ncco1 |
| InChI | InChI=1S/C8H14N2OS/c1-3-9-6-7(2)12-8-10-4-5-11-8/h4-5,7,9H,3,6H2,1-2H3 |
| InChIKey | VTOIUPSZFLTPQV-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-ethyl-2-(1,3-oxazol-2-ylsulfanyl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2-(1,3-oxazol-2-ylsulfanyl)propan-1-amine?
The IUPAC name of N-ethyl-2-(1,3-oxazol-2-ylsulfanyl)propan-1-amine (CID 106925805) is N-ethyl-2-(1,3-oxazol-2-ylsulfanyl)propan-1-amine.
What is the SMILES notation for N-ethyl-2-(1,3-oxazol-2-ylsulfanyl)propan-1-amine?
The canonical SMILES for N-ethyl-2-(1,3-oxazol-2-ylsulfanyl)propan-1-amine is CCNCC(C)Sc1ncco1.
What is the InChIKey of N-ethyl-2-(1,3-oxazol-2-ylsulfanyl)propan-1-amine?
The InChIKey is VTOIUPSZFLTPQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2OS/c1-3-9-6-7(2)12-8-10-4-5-11-8/h4-5,7,9H,3,6H2,1-2H3.
What are the key properties of N-ethyl-2-(1,3-oxazol-2-ylsulfanyl)propan-1-amine?
N-ethyl-2-(1,3-oxazol-2-ylsulfanyl)propan-1-amine has a molecular weight of 186.28 g/mol, XLogP of 1.76, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2-(1,3-oxazol-2-ylsulfanyl)propan-1-amine is sourced from PubChem (CID 106925805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).