About (1-phenylcyclopropyl)methyl 4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]piperidine-1-carboxylate
(1-phenylcyclopropyl)methyl 4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]piperidine-1-carboxylate (PubChem CID 10692610) has the molecular formula C24H28N4O2
and a molecular weight of 404.51 g/mol. Its IUPAC name is (1-phenylcyclopropyl)methyl 4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | (1-phenylcyclopropyl)methyl 4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]piperidine-1-carboxylate |
| PubChem CID | 10692610 |
| Molecular Formula | C24H28N4O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | (1-phenylcyclopropyl)methyl 4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]piperidine-1-carboxylate |
| SMILES | Cc1nc2cnccc2n1CC1CCN(C(=O)OCC2(c3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C24H28N4O2/c1-18-26-21-15-25-12-7-22(21)28(18)16-19-8-13-27(14-9-19)23(29)30-17-24(10-11-24)20-5-3-2-4-6-20/h2-7,12,15,19H,8-11,13-14,16-17H2,1H3 |
| InChIKey | QLCZQDHWIBBCCS-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1-phenylcyclopropyl)methyl 4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-phenylcyclopropyl)methyl 4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]piperidine-1-carboxylate?
The IUPAC name of (1-phenylcyclopropyl)methyl 4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]piperidine-1-carboxylate (CID 10692610) is (1-phenylcyclopropyl)methyl 4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]piperidine-1-carboxylate.
What is the SMILES notation for (1-phenylcyclopropyl)methyl 4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]piperidine-1-carboxylate?
The canonical SMILES for (1-phenylcyclopropyl)methyl 4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]piperidine-1-carboxylate is Cc1nc2cnccc2n1CC1CCN(C(=O)OCC2(c3ccccc3)CC2)CC1.
What is the InChIKey of (1-phenylcyclopropyl)methyl 4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]piperidine-1-carboxylate?
The InChIKey is QLCZQDHWIBBCCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28N4O2/c1-18-26-21-15-25-12-7-22(21)28(18)16-19-8-13-27(14-9-19)23(29)30-17-24(10-11-24)20-5-3-2-4-6-20/h2-7,12,15,19H,8-11,13-14,16-17H2,1H3.
What are the key properties of (1-phenylcyclopropyl)methyl 4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]piperidine-1-carboxylate?
(1-phenylcyclopropyl)methyl 4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]piperidine-1-carboxylate has a molecular weight of 404.51 g/mol, XLogP of 4.32, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-phenylcyclopropyl)methyl 4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]piperidine-1-carboxylate is sourced from PubChem (CID 10692610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).